pseudoakuammigine
pseudoakuammigine structure
|
Common Name | pseudoakuammigine | ||
|---|---|---|---|---|
| CAS Number | 2447-70-3 | Molecular Weight | 366.453 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 498.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C22H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.0±28.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 498.0±45.0 °C at 760 mmHg |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.453 |
| Flash Point | 255.0±28.7 °C |
| Exact Mass | 366.194336 |
| PSA | 42.01000 |
| LogP | 3.16 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | HAGBWVNSVWLTKY-LNKIKWGQSA-N |
| SMILES | CC=C1CN2CCC34c5ccccc5N(C)C35OCC4(C(=O)OC)C1CC25 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
pseudoakuammigine CAS#:2447-70-3 |
| Literature: Vercauteren, J.; Massiot, G.; Le Men-Olivier, L.; Levy, J. Tetrahedron Letters, 1981 , vol. 22, # 30 p. 2871 - 2874 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| pseudoakuammigine |
| Methyl (19Z)-1-methyl-1,2-dihydro-2,17-epoxyakuammilan-16-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester? |
| A: Molecular weight of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester is 366.453. |
| Q: What is the LogP of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester? |
| A: LogP of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester is 3.16. |
| Q: What English synonyms does (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester have? |
| A: English synonyms of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester: pseudoakuammigine, Methyl (19Z)-1-methyl-1,2-dihydro-2,17-epoxyakuammilan-16-carboxylate. |
| Q: What is the SMILES notation of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester? |
| A: SMILES notation of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester is CC=C1CN2CCC34c5ccccc5N(C)C35OCC4(C(=O)OC)C1CC25. |
| Q: What is the boiling point of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester? |
| A: Boiling point of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester is 498.0±45.0 °C at 760 mmHg. |
| Q: What is the English name of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester? |
| A: The English name of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester is (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester. |
| Q: What is the InChIKey of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester? |
| A: InChIKey of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester is HAGBWVNSVWLTKY-LNKIKWGQSA-N. |
| Q: What is the molecular formula of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester? |
| A: Molecular formula of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester is C22H26N2O3. |
| Q: What is the polar surface area (PSA) of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester? |
| A: Polar surface area (PSA) of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester is 42.01000. |
| Q: What is the CAS number of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester? |
| A: CAS number of (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester is 2447-70-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |
| Dayang Chem (Hangzhou) Co., Ltd. |
| naturewill |