CHEMBRDG-BB 5770552 structure
|
Common Name | CHEMBRDG-BB 5770552 | ||
|---|---|---|---|---|
| CAS Number | 24476-07-1 | Molecular Weight | 215.24800 | |
| Density | 1.214g/cm3 | Boiling Point | 418.6ºC at 760 mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 206.9ºC | |
| Name | 3-hydroxy-N,N-dimethylnaphthalene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.214g/cm3 |
|---|---|
| Boiling Point | 418.6ºC at 760 mmHg |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.24800 |
| Flash Point | 206.9ºC |
| Exact Mass | 215.09500 |
| PSA | 40.54000 |
| LogP | 2.24720 |
| Vapour Pressure | 1.34E-07mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | ATDRZFNPPHNGJX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1cc2ccccc2cc1O |
| HS Code | 2924299090 |
|---|
|
~71%
CHEMBRDG-BB 5770552 CAS#:24476-07-1 |
| Literature: Arumugam, Selvanathan; Popik, Vladimir V. Journal of the American Chemical Society, 2009 , vol. 131, # 33 p. 11892 - 11899 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Hydroxy-N,N-dimethyl-2-naphthamide |