monomethyl kolavate
Modify Date: 2025-08-25 20:21:49
monomethyl kolavate structure
|
Common Name | monomethyl kolavate | ||
|---|---|---|---|---|
| CAS Number | 24513-41-5 | Molecular Weight | 348.48 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 456.6±18.0 °C at 760 mmHg | |
| Molecular Formula | C21H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.4±14.7 °C | |
Use of monomethyl kolavateMonomethyl kolavate is a Trypanosoma brucei GAPDH enzyme (TbGAPDH) inhibitor with theIC50 value of 2 µM[1]. |
| Name | (4aR,5S,6R,8aR)-5-[(3E)-5-Methoxy-3-methyl-5-oxo-3-penten-1-yl]-5 ,6,8a-trimethyl-3,4,4a,5,6,7,8,8a-octahydro-1-naphthalenecarboxyl ic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Monomethyl kolavate is a Trypanosoma brucei GAPDH enzyme (TbGAPDH) inhibitor with theIC50 value of 2 µM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 456.6±18.0 °C at 760 mmHg |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 |
| Flash Point | 150.4±14.7 °C |
| Exact Mass | 348.230072 |
| PSA | 63.60000 |
| LogP | 6.59 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | CCDSRPQULZAXRF-HYUHHEBUSA-N |
| SMILES | COC(=O)C=C(C)CCC1(C)C(C)CCC2(C)C(C(=O)O)=CCCC21 |
| Hazard Codes | Xi |
|---|
| Haplopappsaeure |
| Kolavinsaeure |
| 1-Naphthalenecarboxylic acid, 3,4,4a,5,6,7,8,8a-octahydro-5-[(3E)-5-methoxy-3-methyl-5-oxo-3-penten-1-yl]-5,6,8a-trimethyl-, (4aR,5S,6R,8aR)- |
| Glutinic acid |
| kolavic acid 15-monomethyl ester |
| Kolavinsaeure-methylester |
| (4aR,5S,6R,8aR)-5-[(3E)-5-Methoxy-3-methyl-5-oxo-3-penten-1-yl]-5,6,8a-trimethyl-3,4,4a,5,6,7,8,8a-octahydro-1-naphthalenecarboxylic acid |