Ethanol,2,2'-[[4-(2-phenyldiazenyl)phenyl]imino]bis structure
|
Common Name | Ethanol,2,2'-[[4-(2-phenyldiazenyl)phenyl]imino]bis | ||
|---|---|---|---|---|
| CAS Number | 2452-84-8 | Molecular Weight | 285.34100 | |
| Density | 1.15g/cm3 | Boiling Point | 507.4ºC at 760mmHg | |
| Molecular Formula | C16H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.7ºC | |
| Name | 2-[N-(2-hydroxyethyl)-4-phenyldiazenylanilino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 507.4ºC at 760mmHg |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.34100 |
| Flash Point | 260.7ºC |
| Exact Mass | 285.14800 |
| PSA | 68.42000 |
| LogP | 2.89300 |
| Vapour Pressure | 4.05E-11mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | YNXWXVHBJGJPPY-UHFFFAOYSA-N |
| SMILES | OCCN(CCO)c1ccc(N=Nc2ccccc2)cc1 |
| HS Code | 2927000090 |
|---|
|
~%
Ethanol,2,2'-[[... CAS#:2452-84-8 |
| Literature: Everett; Ross Journal of the Chemical Society, 1949 , p. 1972,1974 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| c.i. solvent yellow 58 |