9H-Xanthene-9-carboxylicacid, 2-(diethylamino)ethyl ester structure
|
Common Name | 9H-Xanthene-9-carboxylicacid, 2-(diethylamino)ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 24539-72-8 | Molecular Weight | 325.40200 | |
| Density | 1.143g/cm3 | Boiling Point | 430.7ºC at 760mmHg | |
| Molecular Formula | C20H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.3ºC | |
| Name | 9-xanthene carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 430.7ºC at 760mmHg |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.40200 |
| Flash Point | 214.3ºC |
| Exact Mass | 325.16800 |
| PSA | 38.77000 |
| LogP | 3.80920 |
| Vapour Pressure | 1.27E-07mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | HIGMQFBAGGGECD-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)C1c2ccccc2Oc2ccccc21 |
|
~%
9H-Xanthene-9-c... CAS#:24539-72-8 |
| Literature: Jay; Digenis Journal of Pharmaceutical Sciences, 1982 , vol. 71, # 8 p. 958 - 960 |
|
~%
9H-Xanthene-9-c... CAS#:24539-72-8 |
| Literature: Burtner; Cusic Journal of the American Chemical Society, 1943 , vol. 65, p. 1582 |
|
~%
9H-Xanthene-9-c... CAS#:24539-72-8 |
| Literature: Yoshida; Iwashige Pharmaceutical Bulletin, 1955 , vol. 3, p. 417,420 |
| Xanthanoic acid |
| Xanthene-9-carboxylic acid |
| Xanthen-9-carbonsaeure-(2-diaethylamino-aethylester) |
| Xanthen-9-carbonsaeure |
| xanthene-9-carboxylic acid-(2-diethylamino-ethyl ester) |
| 9-Xanthenylcarboxylic acid |
| Xanthenecarboxylic acid |
| N,N-diethylaminoethyl xanthene-9-carboxylate |