Benzene,1-(2-nitroethenyl)-3-(phenylmethoxy)- structure
|
Common Name | Benzene,1-(2-nitroethenyl)-3-(phenylmethoxy)- | ||
|---|---|---|---|---|
| CAS Number | 24550-32-1 | Molecular Weight | 255.26900 | |
| Density | 1.207g/cm3 | Boiling Point | 417.8ºC at 760 mmHg | |
| Molecular Formula | C15H13NO3 | Melting Point | 93-97ºC(lit.) | |
| MSDS | N/A | Flash Point | 182.3ºC | |
| Name | 1-[(Z)-2-nitroethenyl]-3-phenylmethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 417.8ºC at 760 mmHg |
| Melting Point | 93-97ºC(lit.) |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.26900 |
| Flash Point | 182.3ºC |
| Exact Mass | 255.09000 |
| PSA | 55.05000 |
| LogP | 4.03620 |
| Vapour Pressure | 8.36E-07mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | XFBMDILDMJAPDU-MDZDMXLPSA-N |
| SMILES | O=[N+]([O-])C=Cc1cccc(OCc2ccccc2)c1 |
| Hazard Codes | Xi,N |
|---|---|
| Risk Phrases | R41;R51/53 |
| Safety Phrases | S26;S61;S36/S37/S39 |
| RIDADR | UN 3077 9/PG 3 |
| HS Code | 2909309090 |
|
~%
Benzene,1-(2-ni... CAS#:24550-32-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 20, # 22 p. 6589 - 6597,9 |
|
~%
Benzene,1-(2-ni... CAS#:24550-32-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 20, # 22 p. 6589 - 6597,9 |
|
~88%
Benzene,1-(2-ni... CAS#:24550-32-1 |
| Literature: Conte-Mayweg, Aurelia; Kuehne, Holger; Luebbers, Thomas; Maugeais, Cyrille; Mueller, Werner; Pflieger, Philippe Patent: US2006/30613 A1, 2006 ; Location in patent: Page/Page column 22 ; |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| trans-3-benzyloxy-trans-b-nitrostyrene |
| MFCD02026550 |