2-chloro-5-sulfobenzenediazonium,chloride structure
|
Common Name | 2-chloro-5-sulfobenzenediazonium,chloride | ||
|---|---|---|---|---|
| CAS Number | 24569-40-2 | Molecular Weight | 255.07900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4Cl2N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-5-sulfobenzenediazonium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H4Cl2N2O3S |
|---|---|
| Molecular Weight | 255.07900 |
| Exact Mass | 253.93200 |
| PSA | 111.45000 |
| LogP | 3.17598 |
| InChIKey | VNHWQVAHFBEFMY-UHFFFAOYSA-N |
| SMILES | N#[N+]c1cc(S(=O)(=O)O)ccc1Cl.[Cl-] |
|
~%
2-chloro-5-sulf... CAS#:24569-40-2 |
| Literature: Greenwood, David; Hutchings, Michael G.; Lamble, Brian Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1986 , p. 1107 - 1114 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzenediazonium,2-chloro-5-sulfo-,chloride |
| Benzenediazonium,2-chloro-5-sulfo-,chloride (1:1) |
| Diazo-2-chloroaniline-5-sulfonic acid |
| 2-chloro-5-sulfobenzenediazonium chloride |