2,3-Dibromo-3-(4-chlorophenyl)propanoic Acid structure
|
Common Name | 2,3-Dibromo-3-(4-chlorophenyl)propanoic Acid | ||
|---|---|---|---|---|
| CAS Number | 24653-99-4 | Molecular Weight | 342.41200 | |
| Density | 1.981g/cm3 | Boiling Point | 357.1ºC at 760 mmHg | |
| Molecular Formula | C9H7Br2ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.8ºC | |
| Name | 2,3-Dibromo-3-(4-chlorophenyl)propanoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.981g/cm3 |
|---|---|
| Boiling Point | 357.1ºC at 760 mmHg |
| Molecular Formula | C9H7Br2ClO2 |
| Molecular Weight | 342.41200 |
| Flash Point | 169.8ºC |
| Exact Mass | 339.85000 |
| PSA | 37.30000 |
| LogP | 3.62410 |
| Vapour Pressure | 1.01E-05mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | VVMCVHQTBODLRQ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Br)C(Br)c1ccc(Cl)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,3-DIBROMO-3-(4-CHLOROPHENYL)PROPANOIC ACID |
| 2,3-Dibromo-3-(4-chlorophenyl)propanoic acid |