spongosine structure
|
Common Name | spongosine | ||
|---|---|---|---|---|
| CAS Number | 24723-77-1 | Molecular Weight | 297.27 | |
| Density | 1.98g/cm3 | Boiling Point | 705ºC at 760mmHg | |
| Molecular Formula | C11H15N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 380.2ºC | |
Use of spongosineSpongosine (2-Methoxyadenosine) is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | 2-Methoxyadenosine |
|---|---|
| Synonym | More Synonyms |
| Description | Spongosine (2-Methoxyadenosine) is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.98g/cm3 |
|---|---|
| Boiling Point | 705ºC at 760mmHg |
| Molecular Formula | C11H15N5O5 |
| Molecular Weight | 297.27 |
| Flash Point | 380.2ºC |
| Exact Mass | 297.10700 |
| PSA | 148.77000 |
| Vapour Pressure | 7.3E-21mmHg at 25°C |
| Index of Refraction | 1.829 |
| InChIKey | AJACDNCVEGIBNA-KQYNXXCUSA-N |
| SMILES | COc1nc(N)c2ncn(C3OC(CO)C(O)C3O)c2n1 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| 9H-purin-6-amine |
| 2-Methoxy-adenosin |
| 2-methoxy-adenosine |
| Spongosine |