5-Chloro-2-[[(4-methylphenyl)sulfonyl]amino]benzoic acid methyl ester structure
|
Common Name | 5-Chloro-2-[[(4-methylphenyl)sulfonyl]amino]benzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 247237-38-3 | Molecular Weight | 339.79400 | |
| Density | 1.39 | Boiling Point | 483.9ºC at 760 mmHg | |
| Molecular Formula | C15H14ClNO4S | Melting Point | 115ºC | |
| MSDS | N/A | Flash Point | 246.5ºC | |
| Name | methyl 5-chloro-2-[(4-methylphenyl)sulfonylamino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39 |
|---|---|
| Boiling Point | 483.9ºC at 760 mmHg |
| Melting Point | 115ºC |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.79400 |
| Flash Point | 246.5ºC |
| Exact Mass | 339.03300 |
| PSA | 80.85000 |
| LogP | 4.38960 |
| Vapour Pressure | 1.61E-09mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | ULLAAIMUVLVAJX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(C)cc1 |
|
~95%
5-Chloro-2-[[(4... CAS#:247237-38-3 |
| Literature: Takeda Chemical Industries, Ltd. Patent: EP1174028 A1, 2002 ; Location in patent: Example 19 ; |
|
~%
5-Chloro-2-[[(4... CAS#:247237-38-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 7, # 8 p. 1743 - 1754 |
|
~%
5-Chloro-2-[[(4... CAS#:247237-38-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 7, # 8 p. 1743 - 1754 |
|
~%
5-Chloro-2-[[(4... CAS#:247237-38-3 |
| Literature: Tetrahedron Letters, , vol. 42, # 45 p. 8029 - 8033 |
| Precursor 5 | |
|---|---|
| DownStream 7 | |
| 4'-chloro-2'-methoxycarbonyl-p-toluenesulfonanilide |
| I06-1506 |
| methyl 5-chloro-2-(N-p-toluenesulfonyl)aminobenzoate |
| N-p-toluenesulfonyl-5-chloro-anthranilic acid methyl ester |
| methyl 5-chloranyl-2-[(4-methylphenyl)sulfonylamino]benzoate |
| 5-Chloro-2-(toluene-4-sulfonylamino)-benzoic acid methyl ester |