1,3-bis(4'-Aminophenoxyl)benzene structure
|
Common Name | 1,3-bis(4'-Aminophenoxyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 2479-46-1 | Molecular Weight | 292.332 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 487.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C18H16N2O2 | Melting Point | 115-118 °C(lit.) | |
| MSDS | USA | Flash Point | 270.9±21.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-[3-(4-aminophenoxy)phenoxy]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.3±40.0 °C at 760 mmHg |
| Melting Point | 115-118 °C(lit.) |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.332 |
| Flash Point | 270.9±21.0 °C |
| Exact Mass | 292.121185 |
| PSA | 70.50000 |
| LogP | 2.50 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | WUPRYUDHUFLKFL-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2cccc(Oc3ccc(N)cc3)c2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | BY8236000 |
| HS Code | 2922299090 |
|
~64%
1,3-bis(4'-Amin... CAS#:2479-46-1 |
| Literature: Liu, Ying; Zhang, Guo-Yan; Li, Yang; Zhang, Ya-Nan; Zheng, Song-Zhi; Zhou, Zhao-Xia; An, Sheng-Ji; Jin, Ying-Hua Heteroatom Chemistry, 2013 , vol. 24, # 1 p. 9 - 17 |
|
~%
1,3-bis(4'-Amin... CAS#:2479-46-1 |
| Literature: Heteroatom Chemistry, , vol. 24, # 1 p. 9 - 17 |
|
~%
1,3-bis(4'-Amin... CAS#:2479-46-1 |
| Literature: Heteroatom Chemistry, , vol. 24, # 1 p. 9 - 17 |
|
~%
1,3-bis(4'-Amin... CAS#:2479-46-1 |
| Literature: Arzneimittel-Forschung, , vol. 15, # 6 p. 604 - 608 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4'-(1,3-phenylenebis(oxy))dianiline |
| Resorcinol Bis(4-aminophenyl) Ether |
| MFCD00039154 |
| 1,3-bis(4'-Aminophenoxyl)benzene |
| Benzenamine, 4,4'-[1,3-phenylenebis(oxy)]bis- |
| Resorcinol oxydianiline |
| 1,3-bis(4-aminophenyloxy)benzene |
| 4,4'-[1,3-Phenylenebis(oxy)]dianiline |
| 4,4'-(1,3-Phenylenedioxy)dianiline |
| 1,3-Bis(4-aMinophenoxy)benzene |
| ANILINE,p,p'-(m-PHENYLENEDIOXY)DI |
| RODA |
| resorcinol-bis(4-aminophenyl)ether |
| 4-[3-(4-aminophenoxy)phenoxy]aniline |
| 4,4'-(1,3-phenylenedioxy)bis(aniline) |
| 4,4'-(m-Phenylenedioxy)dianiline |