4,4'-Carbonyldiphthalic acid structure
|
Common Name | 4,4'-Carbonyldiphthalic acid | ||
|---|---|---|---|---|
| CAS Number | 2479-49-4 | Molecular Weight | 358.256 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 734.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C17H10O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 411.7±29.4 °C | |
Use of 4,4'-Carbonyldiphthalic acidBenzophenonetetracarboxylic acid can inprove activity and stability of alkaline phosphatases from psychrophilic and mesophilic organisms.Benzophenonetetracarboxylic acid can improve activity and stability of alkaline phosphatases from psychrophilic and mesophilic organisms by chemically modifying aliphatic or amino groups |
| Name | 4-(3,4-dicarboxybenzoyl)phthalic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Benzophenonetetracarboxylic acid can inprove activity and stability of alkaline phosphatases from psychrophilic and mesophilic organisms.Benzophenonetetracarboxylic acid can improve activity and stability of alkaline phosphatases from psychrophilic and mesophilic organisms by chemically modifying aliphatic or amino groups |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 734.0±60.0 °C at 760 mmHg |
| Molecular Formula | C17H10O9 |
| Molecular Weight | 358.256 |
| Flash Point | 411.7±29.4 °C |
| Exact Mass | 358.032471 |
| PSA | 166.27000 |
| LogP | 1.77 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | UITKHKNFVCYWNG-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(C(=O)O)c(C(=O)O)c1)c1ccc(C(=O)O)c(C(=O)O)c1 |
| Storage condition | 2-8°C |
| HS Code | 2918300090 |
|---|
|
~80%
4,4'-Carbonyldi... CAS#:2479-49-4 |
| Literature: Shibamoto, Akihiro; Iwahama, Takahiro Patent: US2011/71314 A1, 2011 ; Location in patent: Page/Page column 14-15 ; |
|
~%
4,4'-Carbonyldi... CAS#:2479-49-4 |
| Literature: Carbohydrate Polymers, , vol. 95, # 2 p. 768 - 772 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzophenone-3,3',4,4'-tetracarboxylic acid |
| 4,4'-Carbonyldiphthalic acid |
| benzophenone-3,3′,4,4′-tetracarboxylic acid |
| MFCD00020283 |
| EINECS 219-613-1 |
| 1,2-Benzenedicarboxylic acid, 4,4'-carbonylbis- |
| 3,3',4,4'-Benzophenonetetracarboxylic acid |
| 4,4'-carbonyldibenzene-1,2-dicarboxylic acid |
| 3,3′,4,4′-benzophenonetetracarboxylic acid |
| 1,2-Benzenedicarboxylic acid,4,4'-carbonylbis |
| Benzophenonetetracarboxylic acid |