1,3-Propanediol,1-(4-methoxyphenyl)-2,2-dimethyl- structure
|
Common Name | 1,3-Propanediol,1-(4-methoxyphenyl)-2,2-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 24793-83-7 | Molecular Weight | 210.27000 | |
| Density | 1.097g/cm3 | Boiling Point | 359.6ºC at 760 mmHg | |
| Molecular Formula | C12H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.3ºC | |
| Name | 1-(4-methoxyphenyl)-2,2-dimethylpropane-1,3-diol |
|---|
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 359.6ºC at 760 mmHg |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27000 |
| Flash Point | 171.3ºC |
| Exact Mass | 210.12600 |
| PSA | 49.69000 |
| LogP | 1.74710 |
| Vapour Pressure | 8.46E-06mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | OOOBGQWSBZYULR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)C(C)(C)CO)cc1 |
|
~49%
1,3-Propanediol... CAS#:24793-83-7 |
| Literature: Hoeve, Wolter ten; Wynberg, Hans Journal of Organic Chemistry, 1985 , vol. 50, # 23 p. 4508 - 4514 |
|
~%
1,3-Propanediol... CAS#:24793-83-7 |
| Literature: Watanabe, Nobuko; Nagashima, Yasuhiro; Yamazaki, Takahiro; Matsumoto, Masakatsu Tetrahedron, 2003 , vol. 59, # 26 p. 4811 - 4819 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |