2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii)
2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii) structure
|
Common Name | 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii) | ||
|---|---|---|---|---|
| CAS Number | 24803-99-4 | Molecular Weight | 591.45500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H44N4Ni | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C36H44N4Ni |
|---|---|
| Molecular Weight | 591.45500 |
| Exact Mass | 590.29200 |
| PSA | 34.58000 |
| LogP | 6.13420 |
| InChIKey | DIGQQRGHPATISA-UHFFFAOYSA-N |
| SMILES | CCC1=C(CC)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(CC)c5CC)C(CC)=C4CC)c(CC)c3CC.[Ni+2] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 20/21/22 |
| Safety Phrases | 36 |
| RIDADR | NONH for all modes of transport |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
CAS#:67514-01-6
CAS#:373-02-4
CAS#:28375-46-4
CAS#:115120-42-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ni-OEP complex |
| Nickel octaethylporphyrin |
| 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphineni |
| RARECHEM AS SA 0079 |
| MFCD00010242 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii)? |
| A: SMILES notation of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii) is CCC1=C(CC)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(CC)c5CC)C(CC)=C4CC)c(CC)c3CC.[Ni+2]. |
| Q: What are the upstream materials of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii)? |
| A: Related upstream materials(CAS) of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii): 67514-01-6;373-02-4;28375-46-4;115120-42-8. |
| Q: What is the molecular weight of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii)? |
| A: Molecular weight of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii) is 591.45500. |
| Q: What is the safety information for 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii)? |
| A: Safety information for 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii): 36. |
| Q: What is the InChIKey of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii)? |
| A: InChIKey of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii) is DIGQQRGHPATISA-UHFFFAOYSA-N. |
| Q: What is the LogP of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii)? |
| A: LogP of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii) is 6.13420. |
| Q: What is the molecular formula of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii)? |
| A: Molecular formula of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii) is C36H44N4Ni. |
| Q: What is the polar surface area (PSA) of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii)? |
| A: Polar surface area (PSA) of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii) is 34.58000. |
| Q: What is the English name of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii)? |
| A: The English name of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii) is 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii). |
| Q: What is the CAS number of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii)? |
| A: CAS number of 2,3,7,8,12,13,17,18-octaethyl-21h,23h-porphine nickel(ii) is 24803-99-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |