N-Boc-N'-formyl-L-lysine structure
|
Common Name | N-Boc-N'-formyl-L-lysine | ||
|---|---|---|---|---|
| CAS Number | 2483-47-8 | Molecular Weight | 274.31300 | |
| Density | 1.142 g/cm3 | Boiling Point | 521ºC at 760 mmHg | |
| Molecular Formula | C12H22N2O5 | Melting Point | 125-128ºC | |
| MSDS | N/A | Flash Point | 268.9ºC | |
| Name | (2S)-6-formamido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142 g/cm3 |
|---|---|
| Boiling Point | 521ºC at 760 mmHg |
| Melting Point | 125-128ºC |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.31300 |
| Flash Point | 268.9ºC |
| Exact Mass | 274.15300 |
| PSA | 104.73000 |
| LogP | 2.29830 |
| Appearance of Characters | Powder | Off-white to white |
| Vapour Pressure | 2.97E-12mmHg at 25°C |
| Index of Refraction | 1.48 |
| InChIKey | QYCPNUMTVZBTMM-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCCCNC=O)C(=O)O |
| Storage condition | −20°C |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924199090 |
|
~%
N-Boc-N'-formyl... CAS#:2483-47-8 |
| Literature: Hofmann,K. et al. Journal of the American Chemical Society, 1965 , vol. 87, p. 611 - 619 |
|
~%
N-Boc-N'-formyl... CAS#:2483-47-8 |
| Literature: Smuda, Mareen; Voigt, Michael; Glomb, Marcus A. Journal of Agricultural and Food Chemistry, 2010 , vol. 58, # 10 p. 6458 - 6464 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-L-Lys(Form)-OH |
| NA-BOC-NE-FORMYL-L-LYSINE |
| BOC-LYSINE(FOR)-OH |
| N-Boc-N'-formyl-L-lysine |
| NALPHA-TERT-BOC-NEPSILON-FORMYL-L-LYSINE |
| BOC-LYS(CHO)-OH |