Carbonazidic acid,1,1-dimethylethyl ester structure
|
Common Name | Carbonazidic acid,1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1070-19-5 | Molecular Weight | 143.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-diazocarbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H9N3O2 |
|---|---|
| Molecular Weight | 143.14400 |
| Exact Mass | 143.06900 |
| PSA | 76.05000 |
| LogP | 1.68456 |
| InChIKey | ISHLCKAQWKBMAU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N=[N+]=[N-] |
| HS Code | 2927000090 |
|---|
|
~94%
Carbonazidic ac... CAS#:1070-19-5 |
| Literature: Synthelabo Patent: US4134991 A1, 1979 ; |
|
~77%
Carbonazidic ac... CAS#:1070-19-5 |
| Literature: Holzinger, Michael; Abraham, Juergen; Whelan, Paul; Graupner, Ralf; Ley, Lothar; Hennrich, Frank; Kappes, Manfred; Hirsch, Andreas Journal of the American Chemical Society, 2003 , vol. 125, # 28 p. 8566 - 8580 |
|
~%
Carbonazidic ac... CAS#:1070-19-5 |
| Literature: Merck and Co., Inc. Patent: US4558071 A1, 1985 ; |
|
~%
Carbonazidic ac... CAS#:1070-19-5 |
| Literature: Sakai,K.; Anselme,J.-P. Journal of Organic Chemistry, 1971 , vol. 36, # 16 p. 2387 - 2388 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| tert-Butyl azidoformate |
| t-butoxycarbonylazide |
| tert-butoxycarbonyl azide |
| EINECS 213-972-8 |
| t-butyl carbonazidate |
| tert-Butyloxycarbonyl azide |
| tert-Butylcarbazate |