Pregn-4-ene-3,12,20-trione,17-hydroxy- (7CI,9CI) structure
|
Common Name | Pregn-4-ene-3,12,20-trione,17-hydroxy- (7CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 2484-48-2 | Molecular Weight | 344.44500 | |
| Density | 1.21g/cm3 | Boiling Point | 523.2ºC at 760 mmHg | |
| Molecular Formula | C21H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.3ºC | |
| Name | 17-acetyl-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,14,15,16-decahydrocyclopenta[a]phenanthrene-3,12-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 523.2ºC at 760 mmHg |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.44500 |
| Flash Point | 284.3ºC |
| Exact Mass | 344.19900 |
| PSA | 71.44000 |
| LogP | 3.01740 |
| Vapour Pressure | 3.93E-13mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | APJCTMMHYXDGLD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3CC(=O)C21C |
|
~%
Pregn-4-ene-3,1... CAS#:2484-48-2 |
| Literature: Rothman; Wall Journal of the American Chemical Society, 1956 , vol. 78, p. 1744,1746 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 17-Hydroxy-pregn-4-en-3,12,20-trion |
| 17-hydroxypregn-4-ene-3,12,20-trione |