16,17-Epoxypregn-4-ene-3,11,20-trione structure
|
Common Name | 16,17-Epoxypregn-4-ene-3,11,20-trione | ||
|---|---|---|---|---|
| CAS Number | 3684-84-2 | Molecular Weight | 342.42900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H26O4 | Melting Point | 182ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 16α,17-epoxypregn-4-ene-3,11,20-trione |
|---|
| Melting Point | 182ºC |
|---|---|
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.42900 |
| Exact Mass | 342.18300 |
| PSA | 63.74000 |
| LogP | 3.03380 |
| InChIKey | DHQQLMMXRMNZRZ-MNWLJHKSSA-N |
| SMILES | CC(=O)C12OC1CC1C3CCC4=CC(=O)CCC4(C)C3C(=O)CC12C |
|
~%
16,17-Epoxypreg... CAS#:3684-84-2 |
| Literature: Ercoli et al. Gazzetta Chimica Italiana, 1955 , vol. 85, p. 628,634 |
|
~%
16,17-Epoxypreg... CAS#:3684-84-2 |
| Literature: Peterson et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 4428 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |