16,17-Epoxypregn-4-ene-3,11,20-trione
16,17-Epoxypregn-4-ene-3,11,20-trione structure
|
Common Name | 16,17-Epoxypregn-4-ene-3,11,20-trione | ||
|---|---|---|---|---|
| CAS Number | 3684-84-2 | Molecular Weight | 342.42900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H26O4 | Melting Point | 182ºC | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 16α,17-epoxypregn-4-ene-3,11,20-trione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 182ºC |
|---|---|
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.42900 |
| Exact Mass | 342.18300 |
| PSA | 63.74000 |
| LogP | 3.03380 |
| InChIKey | DHQQLMMXRMNZRZ-MNWLJHKSSA-N |
| SMILES | CC(=O)C12OC1CC1C3CCC4=CC(=O)CCC4(C)C3C(=O)CC12C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
16,17-Epoxypreg... CAS#:3684-84-2 |
| Literature: Ercoli et al. Gazzetta Chimica Italiana, 1955 , vol. 85, p. 628,634 |
|
~%
16,17-Epoxypreg... CAS#:3684-84-2 |
| Literature: Peterson et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 4428 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:2484-48-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 16α,17-epoxypregn-4-ene-3,11,20-trione? |
| A: LogP of 16α,17-epoxypregn-4-ene-3,11,20-trione is 3.03380. |
| Q: What is the English name of 16α,17-epoxypregn-4-ene-3,11,20-trione? |
| A: The English name of 16α,17-epoxypregn-4-ene-3,11,20-trione is 16α,17-epoxypregn-4-ene-3,11,20-trione. |
| Q: What are the upstream materials of 16α,17-epoxypregn-4-ene-3,11,20-trione? |
| A: Related upstream materials(CAS) of 16α,17-epoxypregn-4-ene-3,11,20-trione: 3684-83-1;1097-51-4. |
| Q: What is the InChIKey of 16α,17-epoxypregn-4-ene-3,11,20-trione? |
| A: InChIKey of 16α,17-epoxypregn-4-ene-3,11,20-trione is DHQQLMMXRMNZRZ-MNWLJHKSSA-N. |
| Q: What is the molecular formula of 16α,17-epoxypregn-4-ene-3,11,20-trione? |
| A: Molecular formula of 16α,17-epoxypregn-4-ene-3,11,20-trione is C21H26O4. |
| Q: What is the CAS number of 16α,17-epoxypregn-4-ene-3,11,20-trione? |
| A: CAS number of 16α,17-epoxypregn-4-ene-3,11,20-trione is 3684-84-2. |
| Q: What is the polar surface area (PSA) of 16α,17-epoxypregn-4-ene-3,11,20-trione? |
| A: Polar surface area (PSA) of 16α,17-epoxypregn-4-ene-3,11,20-trione is 63.74000. |
| Q: What is the molecular weight of 16α,17-epoxypregn-4-ene-3,11,20-trione? |
| A: Molecular weight of 16α,17-epoxypregn-4-ene-3,11,20-trione is 342.42900. |
| Q: What is the melting point of 16α,17-epoxypregn-4-ene-3,11,20-trione? |
| A: Melting point of 16α,17-epoxypregn-4-ene-3,11,20-trione is 182ºC. |
| Q: What are the downstream products of 16α,17-epoxypregn-4-ene-3,11,20-trione? |
| A: Related downstream products(CAS) of 16α,17-epoxypregn-4-ene-3,11,20-trione: 2484-48-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |