Ethanol, 2-(4-amino-3-nitroanilino)- structure
|
Common Name | Ethanol, 2-(4-amino-3-nitroanilino)- | ||
|---|---|---|---|---|
| CAS Number | 24905-87-1 | Molecular Weight | 197.191 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 436.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H11N3O3 | Melting Point | 93-95ºC | |
| MSDS | N/A | Flash Point | 217.9±25.9 °C | |
| Name | 2-(4-Amino-3-nitroanilino)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.6±35.0 °C at 760 mmHg |
| Melting Point | 93-95ºC |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.191 |
| Flash Point | 217.9±25.9 °C |
| Exact Mass | 197.080048 |
| PSA | 104.10000 |
| LogP | 0.60 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | DAGCJJZWDAVKRE-UHFFFAOYSA-N |
| SMILES | Nc1ccc(NCCO)cc1[N+](=O)[O-] |
| HS Code | 2922199090 |
|---|
|
~%
Ethanol, 2-(4-a... CAS#:24905-87-1 |
| Literature: DE928909 , ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[(4-Amino-3-nitrophenyl)amino]ethanol |
| Ethanol, 2-(4-amino-3-nitroanilino)- |
| EINECS 246-521-9 |
| 1-amino-4-(2'-hydroxyethyl)amino-2-nitrobenzene |
| 2-(4-Amino-3-nitro-anilino)-aethanol |
| MFCD00239473 |
| 2-((4-Amino-3-nitrophenyl)amino)ethanol |
| 2-nitro-4-(2'-hydroxyethylamino)aniline |
| Ethanol, 2-((4-amino-3-nitrophenyl)amino)- |
| Ethanol, 2-[(4-amino-3-nitrophenyl)amino]- |
| 2-(4-amino-3-nitro-anilino)-ethanol |
| 2-amino-5-[(2'-hydroxyethyl)-amino]-nitrobenzene |
| 1-amino-2-nitro-4-(2-hydroxyethyl)aminobenzene |
| HC Red no. 7 |