2,2'-[(4-amino-3-nitrophenyl)imino]bis-Ethanol structure
|
Common Name | 2,2'-[(4-amino-3-nitrophenyl)imino]bis-Ethanol | ||
|---|---|---|---|---|
| CAS Number | 29705-39-3 | Molecular Weight | 241.24400 | |
| Density | 1.422g/cm3 | Boiling Point | 499ºC at 760mmHg | |
| Molecular Formula | C10H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.6ºC | |
| Name | 2-[4-amino-N-(2-hydroxyethyl)-3-nitroanilino]ethanol |
|---|
| Density | 1.422g/cm3 |
|---|---|
| Boiling Point | 499ºC at 760mmHg |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.24400 |
| Flash Point | 255.6ºC |
| Exact Mass | 241.10600 |
| PSA | 115.54000 |
| LogP | 1.07240 |
| Vapour Pressure | 8.87E-11mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | VOLCMGPDRGNUGR-UHFFFAOYSA-N |
| SMILES | Nc1ccc(N(CCO)CCO)cc1[N+](=O)[O-] |
| HS Code | 2922199090 |
|---|
|
~84%
2,2'-[(4-amino-... CAS#:29705-39-3 |
| Literature: Forlani, Luciano; Boga, Carla; Mazza, Milena; Cavrini, Vanni; Andrisano, Vincenza Tetrahedron, 1998 , vol. 54, # 18 p. 4647 - 4654 |
|
~77%
2,2'-[(4-amino-... CAS#:29705-39-3 |
| Literature: Forlani, Luciano; Boga, Carla; Mazza, Milena; Cavrini, Vanni; Andrisano, Vincenza Tetrahedron, 1998 , vol. 54, # 18 p. 4647 - 4654 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |