3,5-Dimethoxy-1,2-benzenedicarboxylic acid dimethyl ester structure
|
Common Name | 3,5-Dimethoxy-1,2-benzenedicarboxylic acid dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 24953-73-9 | Molecular Weight | 254.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 3,5-dimethoxybenzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14O6 |
|---|---|
| Molecular Weight | 254.23600 |
| Exact Mass | 254.07900 |
| PSA | 71.06000 |
| LogP | 1.27700 |
| InChIKey | JUKQMQKLYKDEFP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)cc(OC)c1C(=O)OC |
| HS Code | 2918990090 |
|---|
|
~64%
3,5-Dimethoxy-1... CAS#:24953-73-9 |
| Literature: Harland, Philip A.; Hodge, Philip Synthesis, 1982 , # 3 p. 223 - 225 |
|
~68%
3,5-Dimethoxy-1... CAS#:24953-73-9 |
| Literature: Corral; Lissavetzky; Manzanares Synthesis, 1997 , # 1 p. 29 - 31 |
|
~%
3,5-Dimethoxy-1... CAS#:24953-73-9 |
| Literature: Oxford; Raistrick Biochemical Journal, 1932 , vol. 26, p. 1902,1906 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,5-dimethoxy-phthalic acid dimethyl ester |
| Dimethyl-3,5-dimethoxyphthalat |
| 3,5-Dimethoxyphthalsaeure-dimethylester |
| Dimethyl 3,5-dimethoxyphthalate |