3,5-dihydroxyphthalic acid
Modify Date: 2025-11-26 19:13:43
3,5-dihydroxyphthalic acid structure
|
Common Name | 3,5-dihydroxyphthalic acid | ||
|---|---|---|---|---|
| CAS Number | 3209-07-2 | Molecular Weight | 198.13000 | |
| Density | 1.779g/cm3 | Boiling Point | 508.6ºC at 760 mmHg | |
| Molecular Formula | C8H6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.5ºC | |
| Name | 3,5-dihydroxyphthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.779g/cm3 |
|---|---|
| Boiling Point | 508.6ºC at 760 mmHg |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13000 |
| Flash Point | 275.5ºC |
| Exact Mass | 198.01600 |
| PSA | 115.06000 |
| LogP | 0.49420 |
| Index of Refraction | 1.717 |
| InChIKey | BMNZPIHTZJNWOV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(O)cc(O)c1C(=O)O |
| HS Code | 2918290000 |
|---|
|
~%
3,5-dihydroxyph... CAS#:3209-07-2 |
| Literature: Birkinshaw; Bracken Journal of the Chemical Society, 1942 , p. 368 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:24953-73-9
CAS#:5463-18-3| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 3,5-dihydroxy-phthalic acid |
| 3,5-dihydroxybenzene-1,2-dicarboxylic acid |
| 3,5-Dihydroxy-phthalsaeure |
| Phthalic acid,3,5-dihydroxy |