2-Methyl-2-adamantyl acrylate structure
|
Common Name | 2-Methyl-2-adamantyl acrylate | ||
|---|---|---|---|---|
| CAS Number | 249562-06-9 | Molecular Weight | 220.307 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 284.4±9.0 °C at 760 mmHg | |
| Molecular Formula | C14H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.6±16.1 °C | |
| Name | (2-methyl-2-adamantyl) prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 284.4±9.0 °C at 760 mmHg |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.307 |
| Flash Point | 114.6±16.1 °C |
| Exact Mass | 220.146332 |
| PSA | 26.30000 |
| LogP | 4.23 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | YRPLSAWATHBYFB-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| HS Code | 2916129000 |
|---|
|
~95%
2-Methyl-2-adam... CAS#:249562-06-9 |
| Literature: Sumitomo Chemical Company, Limited Patent: US6344582 B1, 2002 ; Location in patent: Example 2 ; |
|
~89%
2-Methyl-2-adam... CAS#:249562-06-9 |
| Literature: TOSOH CORPORATION Patent: US2003/139613 A1, 2003 ; |
| HS Code | 2916129000 |
|---|---|
| Summary | 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Propenoic acid, 2-methyltricyclo[3.3.1.1]dec-2-yl ester |
| 2-acryloyloxy-2-methyladamantane |
| 2-Methyladamantan-2-yl acrylate |
| 2-methyl-2-adamantyl acrylate |
| (1r,3r,5r,7r)-2-Methyladamantan-2-yl acrylate |
| acrylic acid-2-methyl-2-adamantyl |