2-Methyl-2-adamantyl methacrylate structure
|
Common Name | 2-Methyl-2-adamantyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 177080-67-0 | Molecular Weight | 234.334 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 301.3±11.0 °C at 760 mmHg | |
| Molecular Formula | C15H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.8±16.7 °C | |
| Name | 2-Methacryloyloxy-2-methyladamantane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.3±11.0 °C at 760 mmHg |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.334 |
| Flash Point | 122.8±16.7 °C |
| Exact Mass | 234.161987 |
| PSA | 26.30000 |
| LogP | 4.78 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | FDYDISGSYGFRJM-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| HS Code | 2916140000 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| (2-methyl-2-adamantyl) 2-methylprop-2-enoate |
| (1r,3r,5r,7r)-2-Methyladamantan-2-yl methacrylate |
| 2-Methyl-2-adamantyl Methacrylate |
| 2-Propenoic acid, 2-methyl-, 2-methyltricyclo[3.3.1.1]dec-2-yl ester |
| Methacrylic Acid 2-Methyl-2-adamantyl Ester |
| 2-Methyladamantan-2-yl methacrylate |