(4-NH2)-Exatecan structure
|
Common Name | (4-NH2)-Exatecan | ||
|---|---|---|---|---|
| CAS Number | 2495742-21-5 | Molecular Weight | 403.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H21N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (4-NH2)-Exatecan(4-NH2)-Exatecan, a topoisomerase inhibitor derivative extracted from patent US20200306243A1, compound A. (4-NH2)-Exatecan can be used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | (4-NH2)-Exatecan |
|---|
| Description | (4-NH2)-Exatecan, a topoisomerase inhibitor derivative extracted from patent US20200306243A1, compound A. (4-NH2)-Exatecan can be used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Howard PW, et, al. Compounds and conjugates thereof. US20200306243A1. |
| Molecular Formula | C23H21N3O4 |
|---|---|
| Molecular Weight | 403.43 |
| InChIKey | VMSFUDYSPMXQSY-QHCPKHFHSA-N |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(N)c3c1c2CCC3 |