3-amino-4-hydroxy-N,N-dimethylbenzenesulfonamide structure
|
Common Name | 3-amino-4-hydroxy-N,N-dimethylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 24962-75-2 | Molecular Weight | 216.258 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 396.7±52.0 °C at 760 mmHg | |
| Molecular Formula | C8H12N2O3S | Melting Point | 156-160ºC | |
| MSDS | N/A | Flash Point | 193.7±30.7 °C | |
| Name | 3-amino-4-hydroxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 396.7±52.0 °C at 760 mmHg |
| Melting Point | 156-160ºC |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.258 |
| Flash Point | 193.7±30.7 °C |
| Exact Mass | 216.056870 |
| PSA | 92.01000 |
| LogP | -0.20 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | BLKRLPPJSAMUNN-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)c1ccc(O)c(N)c1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2935009090 |
|
~66%
3-amino-4-hydro... CAS#:24962-75-2 |
| Literature: Ford; Knowles; Lunt; et al. Journal of Medicinal Chemistry, 1986 , vol. 29, # 4 p. 538 - 549 |
|
~%
3-amino-4-hydro... CAS#:24962-75-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 29, # 4 p. 538 - 549 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 3-amino-4-hydroxy-N,N-dimethylbenzenesulphonamide |
| N1,N1-DIMETHYL-3-AMINO-4-HYDROXYBENZENE-1-SULFONAMIDE |
| 3-amino-4-hydroxy-N,N-dimethylbenzenesulfonamide |
| Benzenesulfonamide,3-amino-4-hydroxy-N,N-dimethyl |