4-((4-hydroxyphenyl)azo)benzaldehyde structure
|
Common Name | 4-((4-hydroxyphenyl)azo)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 2497-41-8 | Molecular Weight | 226.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-((4-hydroxyphenyl)azo)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10N2O2 |
|---|---|
| Molecular Weight | 226.23100 |
| Exact Mass | 226.07400 |
| PSA | 62.02000 |
| LogP | 3.62010 |
| InChIKey | UBXVGRPYJAMRAO-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(N=Nc2ccc(O)cc2)cc1 |
|
~%
4-((4-hydroxyph... CAS#:2497-41-8 |
| Literature: Dutt Journal of the Chemical Society, 1926 , p. 1183 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 4-Hydroxy-4'-formyl-azobenzol |
| 4-hydroxy-4'-formylazobenzene |