N-[2-(N-ethyl-m-toluidino)ethyl]phthalimide structure
|
Common Name | N-[2-(N-ethyl-m-toluidino)ethyl]phthalimide | ||
|---|---|---|---|---|
| CAS Number | 2498-02-4 | Molecular Weight | 308.37400 | |
| Density | 1.207g/cm3 | Boiling Point | 470.2ºC at 760mmHg | |
| Molecular Formula | C19H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.1ºC | |
| Name | 2-[2-(N-ethyl-3-methylanilino)ethyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 470.2ºC at 760mmHg |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.37400 |
| Flash Point | 205.1ºC |
| Exact Mass | 308.15200 |
| PSA | 40.62000 |
| LogP | 3.05540 |
| Vapour Pressure | 5.17E-09mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | BMYMLHZMMRCSDA-UHFFFAOYSA-N |
| SMILES | CCN(CCN1C(=O)c2ccccc2C1=O)c1cccc(C)c1 |
|
~%
N-[2-(N-ethyl-m... CAS#:2498-02-4 |
| Literature: Bent et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3100,3101 |
|
~%
N-[2-(N-ethyl-m... CAS#:2498-02-4 |
| Literature: Bent et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3100,3101 |
|
~%
N-[2-(N-ethyl-m... CAS#:2498-02-4 |
| Literature: Bent et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3100,3101 |
| N-<2-(N-ethyl-m-toluidino)-ethyl>-phthalimid |
| N-(2-Phthalimidoethyl)-N-ethyl-m-toluidin |
| N-(2-(N-Ethyl-m-toluidino)ethyl)phthalimide |
| N-[2-(N-Aethyl-m-toluidino)-aethyl]-phthalimid |
| EINECS 219-685-4 |