(2S)-3-(1H-Indol-3-yl)-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxoh exyl]amino}propanoic acid (non-preferred name) structure
|
Common Name | (2S)-3-(1H-Indol-3-yl)-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxoh exyl]amino}propanoic acid (non-preferred name) | ||
|---|---|---|---|---|
| CAS Number | 25020-15-9 | Molecular Weight | 366.36600 | |
| Density | 1.511g/cm3 | Boiling Point | 786ºC at 760mmHg | |
| Molecular Formula | C17H22N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 429.2ºC | |
| Name | (2S)-3-(1H-Indol-3-yl)-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxoh exyl]amino}propanoic acid (non-preferred name) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.511g/cm3 |
|---|---|
| Boiling Point | 786ºC at 760mmHg |
| Molecular Formula | C17H22N2O7 |
| Molecular Weight | 366.36600 |
| Flash Point | 429.2ºC |
| Exact Mass | 366.14300 |
| PSA | 163.11000 |
| Vapour Pressure | 5.02E-26mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | RZJHOCXJFBBOAY-LCGIIJARSA-N |
| SMILES | O=C(O)C(Cc1c[nH]c2ccccc12)NCC(=O)C(O)C(O)C(O)CO |
|
~29%
(2S)-3-(1H-Indo... CAS#:25020-15-9 |
| Literature: Adrover, Miquel; Vilanova, Bartolome; Frau, Juan; Munoz, Francisco; Donoso, Josefa Bioorganic and Medicinal Chemistry, 2008 , vol. 16, # 10 p. 5557 - 5569 |
| N-D-fructose-1-yl-L-valine |
| 1-L-Valine-1-deoxy-D-fructose |
| 1-Deoxy-1-L-valino-D-fructose |
| N-Fructosyl Valine |
| N-D-Fructose-1-yl-L-valin |
| Fructosyl-valine |