ethyl 3-oxo-4,4-diphenylbutanoate structure
|
Common Name | ethyl 3-oxo-4,4-diphenylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 25022-02-0 | Molecular Weight | 282.33400 | |
| Density | 1.117g/cm3 | Boiling Point | 381.9ºC at 760 mmHg | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166ºC | |
| Name | ethyl 3-oxo-4,4-diphenylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 381.9ºC at 760 mmHg |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33400 |
| Flash Point | 166ºC |
| Exact Mass | 282.12600 |
| PSA | 43.37000 |
| LogP | 3.34080 |
| Vapour Pressure | 4.89E-06mmHg at 25°C |
| Index of Refraction | 1.55 |
| InChIKey | BGJHHKOHPAAEBI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C(c1ccccc1)c1ccccc1 |
| HS Code | 2918300090 |
|---|
|
~%
ethyl 3-oxo-4,4... CAS#:25022-02-0 |
| Literature: Augelli-Szafran; Blankley; Roth; Trivedi; Bousley; Essenburg; Hamelehle; Krause; Stanfield Journal of Medicinal Chemistry, 1993 , vol. 36, # 20 p. 2943 - 2949 |
|
~%
ethyl 3-oxo-4,4... CAS#:25022-02-0 |
| Literature: Matsuo; Kimura; Kinuta; Takai; Tanaka Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 10 p. 4197 - 4204 |
|
~%
ethyl 3-oxo-4,4... CAS#:25022-02-0 |
| Literature: Libermann; Hengl Bulletin de la Societe Chimique de France, 1951 , p. 974 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4,4-Diphenyl-acetessigsaeure-ethylester |
| 4,4-Diphenyl-acetessigsaeure-aethylester |
| 3-Keto-4,4-diphenyl-butansaeureaethylester |
| Acetoaceticacid,4,4-diphenyl-,ethyl ester (8CI) |
| Benzenebutanoic acid,b-oxo-g-phenyl-,ethyl ester |
| 4,4-diphenyl-acetoacetic acid ethyl ester |
| 2-Oxo-4,4-diphenyl-buttersaeure-aethylester |
| AC-7804 |