Magnesium ethyl malonate structure
|
Common Name | Magnesium ethyl malonate | ||
|---|---|---|---|---|
| CAS Number | 37517-78-5 | Molecular Weight | 155.41200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H7MgO4+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl bis[3-methoxy-3-oxo-propanoate (1-)-O,O']magnesate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H7MgO4+ |
|---|---|
| Molecular Weight | 155.41200 |
| Exact Mass | 155.01900 |
| PSA | 66.43000 |
| InChIKey | DVWUPYHFVYOPNV-UHFFFAOYSA-L |
| SMILES | CCOC(=O)CC(=O)[O-].CCOC(=O)CC(=O)[O-].[Mg+2] |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| malonic acid monoethyl ester magnesium salt |
| Maleinsaeure-n-hexadecylmonoester |
| 3-ethoxy-3-oxo-propanoic acid magnesium salt |
| ethyl hydrogen malonate magnesium salt |