Poly(bisphenol-A-co-epichlorohydrin) structure
|
Common Name | Poly(bisphenol-A-co-epichlorohydrin) | ||
|---|---|---|---|---|
| CAS Number | 25068-38-6 | Molecular Weight | 853.04900 | |
| Density | 1.18 g/cm3 | Boiling Point | 400.8ºC at 760 mmHg | |
| Molecular Formula | C54H60O9 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 78ºC | |
| Symbol |
GHS05, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | Araldite 506 epoxy resin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18 g/cm3 |
|---|---|
| Boiling Point | 400.8ºC at 760 mmHg |
| Molecular Formula | C54H60O9 |
| Molecular Weight | 853.04900 |
| Flash Point | 78ºC |
| Exact Mass | 852.42400 |
| PSA | 116.07000 |
| LogP | 9.32250 |
| Appearance of Characters | Gardner: ≤3 |
| Vapour Pressure | 5.34E-07mmHg at 25°C |
| InChIKey | KUBDPQJOLOUJRM-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.ClCC1CO1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H314-H317-H350-H411 |
| Precautionary Statements | P201-P273-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,N,Xn |
| Risk Phrases | R45 |
| Safety Phrases | 53-26-36/37-45 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | KC2100000 |
|
Autophagy regulates the therapeutic potential of mesenchymal stem cells in experimental autoimmune encephalomyelitis.
Autophagy 10(7) , 1301-15, (2014) Mesenchymal stem cell (MSC)-based therapy is a promising approach to treat various inflammatory disorders including multiple sclerosis. However, the fate of MSCs in the inflammatory microenvironment i... |
|
|
[Data for toxicological and hygienic evaluation of the new epoxy glue UP-5-207].
Gig. Tr. Prof. Zabol. (7) , 54-5, (1983)
|
| bisphenol a diglycidyl ether resin |