1,2-Bis(4-ethoxyphenyl)-1,2-ethanedione structure
|
Common Name | 1,2-Bis(4-ethoxyphenyl)-1,2-ethanedione | ||
|---|---|---|---|---|
| CAS Number | 2510-73-8 | Molecular Weight | 298.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-Bis(4-ethoxyphenyl)-1,2-ethanedione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H18O4 |
|---|---|
| Molecular Weight | 298.33300 |
| Exact Mass | 298.12100 |
| PSA | 52.60000 |
| LogP | 3.54960 |
| InChIKey | RNIZPDIBRXCMRD-UPHRSURJSA-N |
| SMILES | N#Cc1ccc(C=Cc2ccc(C#N)cc2)cc1 |
|
~96%
1,2-Bis(4-ethox... CAS#:2510-73-8 |
| Literature: Bellucci, Giuseppe; Chiappe, Cinzia; Lo Moro, Giacomo Tetrahedron Letters, 1996 , vol. 37, # 24 p. 4225 - 4228 |
|
~%
1,2-Bis(4-ethox... CAS#:2510-73-8 |
| Literature: Bance; Barber; Woolman Journal of the Chemical Society, 1943 , p. 1,3 |
|
~%
1,2-Bis(4-ethox... CAS#:2510-73-8 |
| Literature: Chen, Yi-Jing; Chen, Chinpiao Tetrahedron Asymmetry, 2007 , vol. 18, # 11 p. 1313 - 1319 |
|
~%
1,2-Bis(4-ethox... CAS#:2510-73-8 |
| Literature: Bance; Barber; Woolman Journal of the Chemical Society, 1943 , p. 1,3 |
| cis-Stilbene |
| meso-1,2-diphenylethylene |
| CIS-STILBEBE |
| ISOSTILBENE |
| cis-4,4'-dicyanostilbene |
| CIS-BIBENZAL |
| 4,4'-Dicyano-cis-stilben |
| CIS-TOLUYLENE |
| 4,4'-Dicyan-cis-stilben |
| Stilbebe |
| cis-4,4'-Dicyan-stilben |