Pentaerythritol Dioleate structure
|
Common Name | Pentaerythritol Dioleate | ||
|---|---|---|---|---|
| CAS Number | 25151-96-6 | Molecular Weight | 665.039 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 688.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C41H76O6 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 187.8±25.0 °C | |
| Name | pentaerythritol dioleate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 688.2±55.0 °C at 760 mmHg |
| Molecular Formula | C41H76O6 |
| Molecular Weight | 665.039 |
| Flash Point | 187.8±25.0 °C |
| Exact Mass | 664.564209 |
| PSA | 93.06000 |
| LogP | 15.77 |
| Vapour Pressure | 0.0±4.9 mmHg at 25°C |
| Index of Refraction | 1.484 |
| InChIKey | BJXXCOMGRRCAGN-CLFAGFIQSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)(CO)COC(=O)CCCCCCCC=CCCCCCCCC |
| HS Code | 2916190090 |
|---|
|
~87%
Pentaerythritol... CAS#:25151-96-6 |
| Literature: Daute, Peter; Reiners, Wilhelm; Schäfer, Martin; Frerichs, Udo; Hildebrandt, Hinrich; Ellerbrake, Joern Patent: US2013/35271 A1, 2013 ; Location in patent: Paragraph 0280 ; |
|
~%
Pentaerythritol... CAS#:25151-96-6 |
| Literature: Tetrahedron Letters, , vol. 40, # 51 p. 8985 - 8988 |
|
~%
Pentaerythritol... CAS#:25151-96-6 |
| Literature: Tetrahedron Letters, , vol. 40, # 51 p. 8985 - 8988 |
|
~82%
Pentaerythritol... CAS#:25151-96-6 |
| Literature: Lizarzaburu, Mike E.; Kurth, Mark J.; Nantz, Michael H. Tetrahedron Letters, 1999 , vol. 40, # 51 p. 8985 - 8988 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Dioleic acid 2,2-bis(hydroxymethyl)-1,3-propanediyl ester |
| Pentaerythritdioleat |
| 9-Octadecenoic acid, 2,2-bis(hydroxymethyl)-1,3-propanediyl ester, (9Z,9'Z)- |
| 9-Octadecenoic acid (Z)-,2,2-bis(hydroxymethyl)-1,3-propanediyl |
| 9-Octadecenoic acid,2,2-bis(hydroxymethyl)-1,3-propanediylester |
| PENTAERYTHRITYL DIOLEATE |
| 9-Octadecenoicacid(Z)-,2,2-bis(hydroxymethyl)-1,3-propanediylester |
| 2,2-Bis(hydroxymethyl)-1,3-propanediyl (9Z,9'Z)bis(-9-octadecenoate) |
| 2,2-bis(hydroxymethyl)-1,3-propanediyl dioleate |
| Pentaerythritol Dioleate |
| pentaerythritoldioeate |
| 2,2-Bis(hydroxymethyl)propane-1,3-diyl (9Z,9'Z)bis-octadec-9-enoate |
| Einecs 246-665-2 |