ethylenebis(oxyethylene) dihexanoate structure
|
Common Name | ethylenebis(oxyethylene) dihexanoate | ||
|---|---|---|---|---|
| CAS Number | 25176-75-4 | Molecular Weight | 346.45900 | |
| Density | 1.003g/cm3 | Boiling Point | 417.5ºC at 760 mmHg | |
| Molecular Formula | C18H34O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.6ºC | |
| Name | 2-[2-(2-hexanoyloxyethoxy)ethoxy]ethyl hexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.003g/cm3 |
|---|---|
| Boiling Point | 417.5ºC at 760 mmHg |
| Molecular Formula | C18H34O6 |
| Molecular Weight | 346.45900 |
| Flash Point | 177.6ºC |
| Exact Mass | 346.23600 |
| PSA | 71.06000 |
| LogP | 3.26660 |
| Vapour Pressure | 3.54E-07mmHg at 25°C |
| Index of Refraction | 1.448 |
| InChIKey | WPMUZECMAFLDQO-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)OCCOCCOCCOC(=O)CCCCC |
| HS Code | 2918990090 |
|---|
|
~95%
ethylenebis(oxy... CAS#:25176-75-4 |
| Literature: Daynard, Tim S.; Eby, Paul S.; Hutchinson, John H. Canadian Journal of Chemistry, 1993 , vol. 71, # 7 p. 1022 - 1028 |
|
~%
ethylenebis(oxy... CAS#:25176-75-4 |
| Literature: Carbide and Carbon Chem.Corp. Patent: US2229222 , 1936 ; |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| triethylene glycol dihexanoate |
| EINECS 246-709-0 |
| 1,2-Bis-(2-hexanoyloxy-aethoxy)-aethan |
| 1,2-bis-(2-hexanoyloxy-ethoxy)-ethane |
| ethane-1,2-diylbis(oxyethane-2,1-diyl) dihexanoate |
| Ethylenebis(oxyethylene) dihexanoate |