4-Chloroindole-3-acetic acid structure
|
Common Name | 4-Chloroindole-3-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2519-61-1 | Molecular Weight | 209.629 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 445.6±30.0 °C at 760 mmHg | |
| Molecular Formula | C10H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.3±24.6 °C | |
| Name | 4-chloroindole-3-acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.6±30.0 °C at 760 mmHg |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.629 |
| Flash Point | 223.3±24.6 °C |
| Exact Mass | 209.024353 |
| PSA | 53.09000 |
| LogP | 2.02 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | WNCFBCKZRJDRKZ-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1c[nH]c2cccc(Cl)c12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 16-26-36 |
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-3-acetic acid, 4-chloro- |
| 4-chloro-3-indolylacetic acid |
| 4-Chloroindole-3-acetic acid |
| 4-Chloroindole-3-acetate |
| 2-(4-chloro-1H-indol-3-yl)acetic acid |
| (4-Chloro-1H-indol-3-yl)acetic acid |
| 4-Cl-Iaa |