2,2-dichloro-1-diethoxyphosphorylethanone
Modify Date: 2025-08-25 17:16:34
2,2-dichloro-1-diethoxyphosphorylethanone structure
|
Common Name | 2,2-dichloro-1-diethoxyphosphorylethanone | ||
|---|---|---|---|---|
| CAS Number | 25196-03-6 | Molecular Weight | 249.02900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11Cl2O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-dichloro-1-diethoxyphosphorylethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H11Cl2O4P |
|---|---|
| Molecular Weight | 249.02900 |
| Exact Mass | 247.97700 |
| PSA | 62.41000 |
| LogP | 2.58280 |
| InChIKey | UEKTXSMCLSCURV-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(=O)C(Cl)Cl |
|
~%
2,2-dichloro-1-... CAS#:25196-03-6 |
| Literature: Barthel et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 2424,2426 |
|
~%
2,2-dichloro-1-... CAS#:25196-03-6 |
| Literature: CIBA Patent: US2719167 , 1954 ; |
|
~%
2,2-dichloro-1-... CAS#:25196-03-6 |
| Literature: Pudovik,A.N.; Gazizov,T.Kh. J. Gen. Chem. USSR (Engl. Transl.), 1969 , vol. 39, p. 2225 - 2231,2172 - 2176 |
| Dichloracetyl-phosphonsaeure-diaethylester |
| Phosphonic acid,(dichloroacetyl)-,diethyl ester |
| Dichloracetylphosphonsaeure-diethylester |
| dichloroacetyl-phosphonic acid diethyl ester |