Benzenesulfonic acid,2-nitro-, 3-(1,1-dimethylethyl)phenyl ester
Benzenesulfonic acid,2-nitro-, 3-(1,1-dimethylethyl)phenyl ester structure
|
Common Name | Benzenesulfonic acid,2-nitro-, 3-(1,1-dimethylethyl)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 25237-68-7 | Molecular Weight | 335.37500 | |
| Density | 1.281g/cm3 | Boiling Point | 478.2ºC at 760mmHg | |
| Molecular Formula | C16H17NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3-tert-butylphenyl) 2-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 478.2ºC at 760mmHg |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.37500 |
| Flash Point | 243ºC |
| Exact Mass | 335.08300 |
| PSA | 97.57000 |
| LogP | 5.26400 |
| Vapour Pressure | 7.57E-09mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | RSHQVNMJYOPWBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cccc(OS(=O)(=O)c2ccccc2[N+](=O)[O-])c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Benzenesulfonic... CAS#:25237-68-7 |
| Literature: Dannley,R.L. et al. Journal of Organic Chemistry, 1970 , vol. 35, # 9 p. 3076 - 3079 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| m-tert.Butylphenyl-o-nitrobenzolsulfonat |
| 3-tert-butylphenyl 2-nitrobenzenesulfonate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (3-tert-butylphenyl) 2-nitrobenzenesulfonate? |
| A: LogP of (3-tert-butylphenyl) 2-nitrobenzenesulfonate is 5.26400. |
| Q: What is the molecular formula of (3-tert-butylphenyl) 2-nitrobenzenesulfonate? |
| A: Molecular formula of (3-tert-butylphenyl) 2-nitrobenzenesulfonate is C16H17NO5S. |
| Q: What English synonyms does (3-tert-butylphenyl) 2-nitrobenzenesulfonate have? |
| A: English synonyms of (3-tert-butylphenyl) 2-nitrobenzenesulfonate: m-tert.Butylphenyl-o-nitrobenzolsulfonat, 3-tert-butylphenyl 2-nitrobenzenesulfonate. |
| Q: What is the CAS number of (3-tert-butylphenyl) 2-nitrobenzenesulfonate? |
| A: CAS number of (3-tert-butylphenyl) 2-nitrobenzenesulfonate is 25237-68-7. |
| Q: What is the boiling point of (3-tert-butylphenyl) 2-nitrobenzenesulfonate? |
| A: Boiling point of (3-tert-butylphenyl) 2-nitrobenzenesulfonate is 478.2ºC at 760mmHg. |
| Q: What is the SMILES notation of (3-tert-butylphenyl) 2-nitrobenzenesulfonate? |
| A: SMILES notation of (3-tert-butylphenyl) 2-nitrobenzenesulfonate is CC(C)(C)c1cccc(OS(=O)(=O)c2ccccc2[N+](=O)[O-])c1. |
| Q: What are the upstream materials of (3-tert-butylphenyl) 2-nitrobenzenesulfonate? |
| A: Related upstream materials(CAS) of (3-tert-butylphenyl) 2-nitrobenzenesulfonate: 585-34-2;1694-92-4. |
| Q: What is the Chinese name of 25237-68-7? |
| A: Chinese name of 25237-68-7 is 25237-68-7. |
| Q: What is the English name of (3-tert-butylphenyl) 2-nitrobenzenesulfonate? |
| A: The English name of (3-tert-butylphenyl) 2-nitrobenzenesulfonate is (3-tert-butylphenyl) 2-nitrobenzenesulfonate. |
| Q: What is the molecular weight of (3-tert-butylphenyl) 2-nitrobenzenesulfonate? |
| A: Molecular weight of (3-tert-butylphenyl) 2-nitrobenzenesulfonate is 335.37500. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |