Benzenesulfonic acid, 2-nitro-, 2-methylphenyl ester structure
|
Common Name | Benzenesulfonic acid, 2-nitro-, 2-methylphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 25238-19-1 | Molecular Weight | 293.29500 | |
| Density | 1.388g/cm3 | Boiling Point | 468.4ºC at 760mmHg | |
| Molecular Formula | C13H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.1ºC | |
| Name | (2-methylphenyl) 2-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.388g/cm3 |
|---|---|
| Boiling Point | 468.4ºC at 760mmHg |
| Molecular Formula | C13H11NO5S |
| Molecular Weight | 293.29500 |
| Flash Point | 237.1ºC |
| Exact Mass | 293.03600 |
| PSA | 97.57000 |
| LogP | 4.27490 |
| Vapour Pressure | 1.69E-08mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | ZHDLPWZPIPVLMQ-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
|
~%
Benzenesulfonic... CAS#:25238-19-1 |
| Literature: Etabl.Kuhlmann Patent: US2134642 , 1937 ; Full Text Show Details Etabl.Kuhlmann Patent: FR821551 , 1936 ; |
|
~%
Benzenesulfonic... CAS#:25238-19-1 |
| Literature: Dannley,R.L. et al. Journal of Organic Chemistry, 1970 , vol. 35, # 9 p. 3076 - 3079 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-nitro-benzenesulfonic acid o-tolyl ester |
| 2-Nitro-benzolsulfonsaeure-o-tolylester |
| 2-methylphenyl 2-nitrobenzenesulfonate |
| o-Methylphenyl-o-nitrobenzolsulfonat |