Benzenesulfonylfluoride, 4-[[[[3-(2-chloro-4-nitrophenoxy)propyl]amino]carbonyl]amino]- structure
|
Common Name | Benzenesulfonylfluoride, 4-[[[[3-(2-chloro-4-nitrophenoxy)propyl]amino]carbonyl]amino]- | ||
|---|---|---|---|---|
| CAS Number | 25240-54-4 | Molecular Weight | 431.82300 | |
| Density | 1.503g/cm3 | Boiling Point | 578.7ºC at 760 mmHg | |
| Molecular Formula | C16H15ClFN3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.8ºC | |
| Name | 4-[3-(2-chloro-4-nitrophenoxy)propylcarbamoylamino]benzenesulfonyl fluoride |
|---|
| Density | 1.503g/cm3 |
|---|---|
| Boiling Point | 578.7ºC at 760 mmHg |
| Molecular Formula | C16H15ClFN3O6S |
| Molecular Weight | 431.82300 |
| Flash Point | 303.8ºC |
| Exact Mass | 431.03500 |
| PSA | 138.70000 |
| LogP | 5.56490 |
| Vapour Pressure | 2.17E-13mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | FSHVNZDQGACUTL-UHFFFAOYSA-N |
| SMILES | O=C(NCCCOc1ccc([N+](=O)[O-])cc1Cl)Nc1ccc(S(=O)(=O)F)cc1 |
|
~%
Benzenesulfonyl... CAS#:25240-54-4 |
| Literature: Baker; Janson Journal of medicinal chemistry, 1969 , vol. 12, # 4 p. 672 - 676 |
|
~%
Benzenesulfonyl... CAS#:25240-54-4 |
| Literature: Journal of medicinal chemistry, , vol. 12, # 4 p. 672 - 676 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |