dichlorotriphenylphosphorane structure
|
Common Name | dichlorotriphenylphosphorane | ||
|---|---|---|---|---|
| CAS Number | 2526-64-9 | Molecular Weight | 333.19100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15Cl2P | Melting Point | 85ºC | |
| MSDS | Chinese USA | Flash Point | 68 °F | |
| Symbol |
GHS02, GHS05, GHS08 |
Signal Word | Danger | |
| Name | dichloro(triphenyl)-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 85ºC |
|---|---|
| Molecular Formula | C18H15Cl2P |
| Molecular Weight | 333.19100 |
| Flash Point | 68 °F |
| Exact Mass | 332.02900 |
| PSA | 13.59000 |
| LogP | 4.82380 |
| InChIKey | ASWXNYNXAOQCCD-UHFFFAOYSA-N |
| SMILES | ClP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| Water Solubility | Reacts with water. |
| Symbol |
GHS02, GHS05, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H228-H314-H350 |
| Precautionary Statements | P201-P210-P280-P305 + P351 + P338-P310 |
| Hazard Codes | F: Flammable;T: Toxic; |
| Risk Phrases | R45;R11;R34 |
| Safety Phrases | 53-26-36/37/39-45-16 |
| RIDADR | UN 2925 |
| WGK Germany | 3 |
| Packaging Group | II |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Development of new N-Arylbenzamides as STAT3 Dimerization Inhibitors.
MedChemComm 4(6) , 932-941, (2013) The O-tosylsalicylamide S3I-201 (10) was used as a starting point for design and synthesis of novel STAT-3 dimerization inhibitors with improved drug-like qualities. The phosphonic acid 12d and salicy... |
|
|
Simple and convenient synthesis of tertiary benzanilides using dichlorotriphenylphosphorane. Azumaya I, et al.
Tetrahedron 59(13) , 2325-31, (2003)
|
|
|
Cleavage of carboxylic acid esters to acid chlorides with dichlorotriphenylphosphorane. Burton DKJ and Koppes WM.
J. Org. Chem. 40(21) , 3026-3032., (1975)
|
| MFCD00010359 |
| Dichlorotriphenylphosphorane |
| triphenylphosphine dichloride |
| triphenyldichlorophosphorane |
| triphenylphosphine chloride |