Phosphoric acid,trihexyl ester structure
|
Common Name | Phosphoric acid,trihexyl ester | ||
|---|---|---|---|---|
| CAS Number | 2528-39-4 | Molecular Weight | 350.47400 | |
| Density | 0.95g/cm3 | Boiling Point | 354.1ºC at 760mmHg | |
| Molecular Formula | C18H39O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.6ºC | |
| Name | trihexyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.95g/cm3 |
|---|---|
| Boiling Point | 354.1ºC at 760mmHg |
| Molecular Formula | C18H39O4P |
| Molecular Weight | 350.47400 |
| Flash Point | 181.6ºC |
| Exact Mass | 350.25900 |
| PSA | 54.57000 |
| LogP | 6.88520 |
| Appearance of Characters | Liquid | Colorless |
| Vapour Pressure | 6.99E-05mmHg at 25°C |
| Index of Refraction | 1.441 |
| InChIKey | SFENPMLASUEABX-UHFFFAOYSA-N |
| SMILES | CCCCCCOP(=O)(OCCCCCC)OCCCCCC |
|
~%
Phosphoric acid... CAS#:2528-39-4 |
| Literature: US2573658 , ; |
|
~86%
Phosphoric acid... CAS#:2528-39-4 |
| Literature: Romakhin; Nikitin Russian Journal of General Chemistry, 1998 , vol. 68, # 7 p. 1023 - 1026 |
|
~%
Phosphoric acid... CAS#:2528-39-4 |
| Literature: Journal of the Chemical Society, , p. 1311 |
|
~%
Phosphoric acid... CAS#:2528-39-4 |
| Literature: Bull. Russ. Acad. Sci. Div. Chem. Sci. (Engl. Transl.), , vol. 41, # 6.1 p. 1328 - 1333,1036 - 1040 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| HEXYL PHOSPHATE |
| MFCD00015351 |
| Phosphorsaeure-trihexylester |
| tri-n-hexyl phosphate |
| Trihexylphosphat |
| EINECS 219-774-8 |
| Phosphoric acid,trihexyl ester |