Acetamide,2-(4-chlorophenoxy)-N-3-pyridinyl- structure
|
Common Name | Acetamide,2-(4-chlorophenoxy)-N-3-pyridinyl- | ||
|---|---|---|---|---|
| CAS Number | 25288-09-9 | Molecular Weight | 262.69200 | |
| Density | 1.339g/cm3 | Boiling Point | 489.6ºC at 760mmHg | |
| Molecular Formula | C13H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.9ºC | |
| Name | 2-(4-chlorophenoxy)-N-(pyridin-3-yl)acetamide |
|---|
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 489.6ºC at 760mmHg |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.69200 |
| Flash Point | 249.9ºC |
| Exact Mass | 262.05100 |
| PSA | 51.22000 |
| LogP | 2.82550 |
| Vapour Pressure | 9.84E-10mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | OZJHZKCVDFOSNG-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc(Cl)cc1)Nc1cccnc1 |
|
~%
Acetamide,2-(4-... CAS#:25288-09-9 |
| Literature: Xia, Shuai; Wang, Li-Ying; Sun, Heng-Zhi; Yue, Huan; Wang, Xiu-Hua; Tan, Jia-Lian; Wang, Yin; Hou, Di; He, Xiao-Yan; Mun, Ki-Cheol; Kumar, B. Prem; Zuo, Hua; Shin, Dong-Soo Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 2 p. 394 - 398 |
|
~%
Acetamide,2-(4-... CAS#:25288-09-9 |
| Literature: Xia, Shuai; Wang, Li-Ying; Sun, Heng-Zhi; Yue, Huan; Wang, Xiu-Hua; Tan, Jia-Lian; Wang, Yin; Hou, Di; He, Xiao-Yan; Mun, Ki-Cheol; Kumar, B. Prem; Zuo, Hua; Shin, Dong-Soo Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 2 p. 394 - 398 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |