2-[(3-Aminophenyl)amino]benzoic acid
Modify Date: 2025-09-02 09:50:08
![2-[(3-Aminophenyl)amino]benzoic acid Structure](https://image.chemsrc.com/caspic/328/25293-29-2.png)
2-[(3-Aminophenyl)amino]benzoic acid structure
|
Common Name | 2-[(3-Aminophenyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 25293-29-2 | Molecular Weight | 228.24700 | |
| Density | 1.34g/cm3 | Boiling Point | 446.8ºC at 760mmHg | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224ºC | |
| Name | 2-(3-aminoanilino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 446.8ºC at 760mmHg |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.24700 |
| Flash Point | 224ºC |
| Exact Mass | 228.09000 |
| PSA | 75.35000 |
| LogP | 3.36480 |
| Vapour Pressure | 9.11E-09mmHg at 25°C |
| Index of Refraction | 1.713 |
| InChIKey | UIPDOEPZZQRQKQ-UHFFFAOYSA-N |
| SMILES | Nc1cccc(Nc2ccccc2C(=O)O)c1 |
| HS Code | 2922499990 |
|---|
|
~%
2-[(3-Aminophen... CAS#:25293-29-2 |
| Literature: Sharples Journal of Pharmacy and Pharmacology, 1982 , vol. 34, # 10 p. 681 - 683 |
|
~%
2-[(3-Aminophen... CAS#:25293-29-2 |
| Literature: Ullmann Justus Liebigs Annalen der Chemie, 1907 , vol. 355, p. 335 |
![Benzoic acid,2-[(3-nitrophenyl)amino] structure](https://image.chemsrc.com/caspic/255/27693-70-5.png)
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3'-Amino-diphenylamin-carbonsaeure-(2) |
| 2-[(3-aminophenyl)amino]benzoic acid |
| N-(m-Aminophenyl)anthranilic acid |
| N-(3-Amino-phenyl)-anthranilsaeure |
| Anthranilic acid,N-(m-aminophenyl) |
| N-(3'-Aminophenyl)anthranilic acid |