ethyl 2-nitrobutanoate structure
|
Common Name | ethyl 2-nitrobutanoate | ||
|---|---|---|---|---|
| CAS Number | 2531-81-9 | Molecular Weight | 161.15600 | |
| Density | 1.096 g/mL at 25ºC(lit.) | Boiling Point | 82-83ºC8 mm Hg(lit.) | |
| Molecular Formula | C6H11NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 186 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ethyl 2-nitrobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.096 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 82-83ºC8 mm Hg(lit.) |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.15600 |
| Flash Point | 186 °F |
| Exact Mass | 161.06900 |
| PSA | 72.12000 |
| LogP | 1.12800 |
| Vapour Pressure | 0.185mmHg at 25°C |
| Index of Refraction | n20/D 1.423(lit.) |
| InChIKey | IENPWWUIYXMCJY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC)[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2915900090 |
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|
Ethyl α-Nitrobutyrate. Kornblum N and Blackwood RK.
Organometallic Syntheses , 44-44, (1957)
|
| 2-Nitro-butansaeure-(1)-aethylester |
| ethyl-2-nitrobutyrate |
| MFCD00075585 |
| 2-nitro-butyric acid ethyl ester |
| 2-Nitro-buttersaeure-aethylester |
| 2-nitrobutanoic acid ethyl ester |