N-(2,5-Dihydroxybenzoyl)glycine structure
|
Common Name | N-(2,5-Dihydroxybenzoyl)glycine | ||
|---|---|---|---|---|
| CAS Number | 25351-24-0 | Molecular Weight | 211.17 | |
| Density | 1.532g/cm3 | Boiling Point | 530.1ºC at 760mmHg | |
| Molecular Formula | C9H9NO5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 274.4ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
Use of N-(2,5-Dihydroxybenzoyl)glycineGentisuric acid, a metabolite of Aspirin (HY-14654), is a substrate of α-amidating monooxygenase (PAM). Gentisuric acid prevents DNA-damage by Mitomycin C (HY-13316)[1][2]. |
| Name | 2-[(2,5-dihydroxybenzoyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Gentisuric acid, a metabolite of Aspirin (HY-14654), is a substrate of α-amidating monooxygenase (PAM). Gentisuric acid prevents DNA-damage by Mitomycin C (HY-13316)[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.532g/cm3 |
|---|---|
| Boiling Point | 530.1ºC at 760mmHg |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 |
| Flash Point | 274.4ºC |
| Exact Mass | 211.04800 |
| PSA | 106.86000 |
| LogP | 0.30310 |
| Vapour Pressure | 4.58E-12mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | FBFATOOJCPDQOZ-UHFFFAOYSA-N |
| SMILES | O=C(O)CNC(=O)c1cc(O)ccc1O |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918290000 |
|
~%
N-(2,5-Dihydrox... CAS#:25351-24-0 |
| Literature: Chemical Communications, , # 47 p. 6393 - 6395 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Gentisuric acid |
| Gentisuric Acid |
| N-(2,5-Dihydroxybenzoyl)glycine |
| 2,5-Dihydroxyhippuric acid |
| 2,5-Dihydroxybenzoyl-N-glycine |