3-aminopropyltris(trimethylsiloxy)silane structure
|
Common Name | 3-aminopropyltris(trimethylsiloxy)silane | ||
|---|---|---|---|---|
| CAS Number | 25357-81-7 | Molecular Weight | 353.753 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 300.8±44.0 °C at 760 mmHg | |
| Molecular Formula | C12H35NO3Si4 | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 135.7±28.4 °C | |
| Name | 3-tris(trimethylsilyloxy)silylpropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 300.8±44.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C12H35NO3Si4 |
| Molecular Weight | 353.753 |
| Flash Point | 135.7±28.4 °C |
| Exact Mass | 353.169403 |
| PSA | 53.71000 |
| LogP | 6.17 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.430 |
| InChIKey | KCJAIHQXOQUWTI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](CCCN)(O[Si](C)(C)C)O[Si](C)(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 3-{1,1,1,5,5,5-Hexamethyl-3-[(trimethylsilyl)oxy]-3-trisiloxanyl}-1-propanamine |
| 3-{1,1,1,5,5,5-Hexamethyl-3-[(trimethylsilyl)oxy]trisiloxan-3-yl}propan-1-amine |
| 3-(1,1,1,5,5,5-Hexamethyl-3-((trimethylsilyl)oxy)trisiloxan-3-yl)propan-1-amine |
| 3-aminopropyltris(trimethylsiloxy)silane |