bis(dimethylamino)phenylchlorosilane structure
|
Common Name | bis(dimethylamino)phenylchlorosilane | ||
|---|---|---|---|---|
| CAS Number | 25374-10-1 | Molecular Weight | 228.79400 | |
| Density | 1.05g/cm3 | Boiling Point | 127ºC | |
| Molecular Formula | C10H17ClN2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 73ºC | |
| Name | N-[chloro-(dimethylamino)-phenylsilyl]-N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 127ºC |
| Molecular Formula | C10H17ClN2Si |
| Molecular Weight | 228.79400 |
| Flash Point | 73ºC |
| Exact Mass | 228.08500 |
| PSA | 6.48000 |
| LogP | 1.19450 |
| Vapour Pressure | 0.027mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | JNVKCQAGHOQPFY-UHFFFAOYSA-N |
| SMILES | CN(C)[Si](Cl)(c1ccccc1)N(C)C |
| Risk Phrases | 36/38 |
|---|---|
| Safety Phrases | 26-27-28-36 |
| HS Code | 2931900090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| EINECS 246-907-7 |
| 1-chloro-N,N,N',N'-tetramethyl-1-phenylsilanediamine |
| Silanediamine,1-chloro-N,N,N',N'-tetramethyl-1-phenyl |