(4,5-diacetyloxy-9,10-dioxoanthracen-2-yl)methyl acetate structure
|
Common Name | (4,5-diacetyloxy-9,10-dioxoanthracen-2-yl)methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 25395-11-3 | Molecular Weight | 396.34700 | |
| Density | 1.38g/cm3 | Boiling Point | 579.7ºC at 760 mmHg | |
| Molecular Formula | C21H16O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.1ºC | |
| Name | (4,5-diacetyloxy-9,10-dioxoanthracen-2-yl)methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 579.7ºC at 760 mmHg |
| Molecular Formula | C21H16O8 |
| Molecular Weight | 396.34700 |
| Flash Point | 254.1ºC |
| Exact Mass | 396.08500 |
| PSA | 113.04000 |
| LogP | 2.37570 |
| Vapour Pressure | 1.96E-13mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | XWXLCJZCCDHZGN-UHFFFAOYSA-N |
| SMILES | CC(=O)OCc1cc(OC(C)=O)c2c(c1)C(=O)c1cccc(OC(C)=O)c1C2=O |
| HS Code | 2915390090 |
|---|
|
~74%
(4,5-diacetylox... CAS#:25395-11-3 |
| Literature: Shi, Da-Hua; Huang, Wei; Li, Chao; Wang, Ling-Ting; Wang, Shi-Fan Bioorganic and Medicinal Chemistry, 2013 , vol. 21, # 5 p. 1064 - 1073 |
|
~%
(4,5-diacetylox... CAS#:25395-11-3 |
| Literature: Proceedings - Indian Academy of Sciences, Section A, , vol. 44, p. 418,421 |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 1,8-diacetoxy-3-acetoxymethyl-anthraquinone |
| 1,8-BIS(ACETYLOXY)-3-[(ACETYLOXY)METHYL]-9,10-ANTHRACENEDIONE |
| Aloeemodin-triacetat |
| Tris-O-acetyl-aloe-emodin |
| Triacetyl Aloe-emodin (Impurity A) |
| aloe-emodin triacetate |
| 1,8-Diacetoxy-3-acetoxymethyl-anthrachinon |
| Aloe-emodin Impurity A |
| Diacerein Impurity 7 |