Boc-β-homo-Asp(OBzl)-OH structure
|
Common Name | Boc-β-homo-Asp(OBzl)-OH | ||
|---|---|---|---|---|
| CAS Number | 254101-10-5 | Molecular Weight | 337.36800 | |
| Density | 1.197g/cm3 | Boiling Point | 522.6ºC at 760mmHg | |
| Molecular Formula | C17H23NO6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 269.9ºC | |
Use of Boc-β-homo-Asp(OBzl)-OHBoc-β-HoAsp(OBzl)-OH is a glutamic acid derivative[1]. |
| Name | Boc-L-β-glutamic acid 5-benzyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-β-HoAsp(OBzl)-OH is a glutamic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 522.6ºC at 760mmHg |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.36800 |
| Flash Point | 269.9ºC |
| Exact Mass | 337.15300 |
| PSA | 101.93000 |
| LogP | 2.87880 |
| Vapour Pressure | 9.49E-12mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | FAFJSSKTLCNWRJ-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)CC(=O)OCc1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Boc-b-Glu(OBzl)-OH |
| N-Boc-L-beta-glutamic acid 5-benzyl ester |
| Boc-β-Glu(OBzl)-OH |
| Boc--HoAsp(OBzl)-OH |
| Boc-Beta-HoAsp(OBzl)-OH |
| BOC-ASPH(OBZL)-(C*CH2)OH |
| Boc-beta-homoaspartic acid(OBzl) |
| MFCD01862861 |
| szlig |
| BOC-B-HOMO-ASP(OBZL)-OH |
| Boc-β-homo-Asp(OBzl)-OH |